C15H14N2O3 — CID 135059817
ethyl 8-methoxy-9H-pyrido[2,3-b]indole-6-carboxylate (PubChem CID 135059817) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is ethyl 8-methoxy-9H-pyrido[2,3-b]indole-6-carboxylate.
| Compound Name | ethyl 8-methoxy-9H-pyrido[2,3-b]indole-6-carboxylate |
|---|---|
| PubChem CID | 135059817 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | ethyl 8-methoxy-9H-pyrido[2,3-b]indole-6-carboxylate |
| SMILES | CCOC(=O)c1cc(OC)c2[nH]c3ncccc3c2c1 |
| InChI | InChI=1S/C15H14N2O3/c1-3-20-15(18)9-7-11-10-5-4-6-16-14(10)17-13(11)12(8-9)19-2/h4-8H,3H2,1-2H3,(H,16,17) |
| InChIKey | AMWOYYNCBZMFOM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |