C15H14N2O3 — CID 117428854
ethyl 2-hydroxy-2-(9H-pyrido[2,3-b]indol-6-yl)acetate (PubChem CID 117428854) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(9H-pyrido[2,3-b]indol-6-yl)acetate.
| Compound Name | ethyl 2-hydroxy-2-(9H-pyrido[2,3-b]indol-6-yl)acetate |
|---|---|
| PubChem CID | 117428854 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | ethyl 2-hydroxy-2-(9H-pyrido[2,3-b]indol-6-yl)acetate |
| SMILES | CCOC(=O)C(O)c1ccc2[nH]c3ncccc3c2c1 |
| InChI | InChI=1S/C15H14N2O3/c1-2-20-15(19)13(18)9-5-6-12-11(8-9)10-4-3-7-16-14(10)17-12/h3-8,13,18H,2H2,1H3,(H,16,17) |
| InChIKey | ZFUGGCMETLSUMB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |