C14H15N3O — CID 115004279
2-(methylamino)-1-(9H-pyrido[2,3-b]indol-6-yl)ethanol (PubChem CID 115004279) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-(methylamino)-1-(9H-pyrido[2,3-b]indol-6-yl)ethanol.
| Compound Name | 2-(methylamino)-1-(9H-pyrido[2,3-b]indol-6-yl)ethanol |
|---|---|
| PubChem CID | 115004279 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-(methylamino)-1-(9H-pyrido[2,3-b]indol-6-yl)ethanol |
| SMILES | CNCC(O)c1ccc2[nH]c3ncccc3c2c1 |
| InChI | InChI=1S/C14H15N3O/c1-15-8-13(18)9-4-5-12-11(7-9)10-3-2-6-16-14(10)17-12/h2-7,13,15,18H,8H2,1H3,(H,16,17) |
| InChIKey | BYKDGJYQBZSVAR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |