C11H11N3 — CID 16757321
4-(1H-pyrrolo[3,2-b]pyridin-2-yl)butanenitrile (PubChem CID 16757321) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-(1H-pyrrolo[3,2-b]pyridin-2-yl)butanenitrile.
| Compound Name | 4-(1H-pyrrolo[3,2-b]pyridin-2-yl)butanenitrile |
|---|---|
| PubChem CID | 16757321 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 4-(1H-pyrrolo[3,2-b]pyridin-2-yl)butanenitrile |
| SMILES | N#CCCCc1cc2ncccc2[nH]1 |
| InChI | InChI=1S/C11H11N3/c12-6-2-1-4-9-8-11-10(14-9)5-3-7-13-11/h3,5,7-8,14H,1-2,4H2 |
| InChIKey | ZVIYSYKBMLKFCM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|