C13H11F3N2O3 — CID 141153042
6-(2-methylpropanoyl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione (PubChem CID 141153042) has the molecular formula C13H11F3N2O3 and a molecular weight of 300.24 g/mol. Its IUPAC name is 6-(2-methylpropanoyl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 6-(2-methylpropanoyl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 141153042 |
| Molecular Formula | C13H11F3N2O3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 6-(2-methylpropanoyl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione |
| SMILES | CC(C)C(=O)c1cc2c(=O)[nH]c(=O)[nH]c2cc1C(F)(F)F |
| InChI | InChI=1S/C13H11F3N2O3/c1-5(2)10(19)6-3-7-9(4-8(6)13(14,15)16)17-12(21)18-11(7)20/h3-5H,1-2H3,(H2,17,18,20,21) |
| InChIKey | MMEFYYQESQWQNU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |