C12H8N2O2 — CID 91356808
4-hydroxy-10H-benzo[b][1,7]naphthyridin-5-one (PubChem CID 91356808) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 4-hydroxy-10H-benzo[b][1,7]naphthyridin-5-one.
| Compound Name | 4-hydroxy-10H-benzo[b][1,7]naphthyridin-5-one |
|---|---|
| PubChem CID | 91356808 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 4-hydroxy-10H-benzo[b][1,7]naphthyridin-5-one |
| SMILES | O=c1c2ccccc2[nH]c2cncc(O)c12 |
| InChI | InChI=1S/C12H8N2O2/c15-10-6-13-5-9-11(10)12(16)7-3-1-2-4-8(7)14-9/h1-6,15H,(H,14,16) |
| InChIKey | FESXUFWWLVOLOL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|