C21H13N3O3 — CID 139905975
7,14-dioxo-5,12-dihydroquinolino[2,3-b]acridine-1-carboxamide (PubChem CID 139905975) has the molecular formula C21H13N3O3 and a molecular weight of 355.35 g/mol. Its IUPAC name is 7,14-dioxo-5,12-dihydroquinolino[2,3-b]acridine-1-carboxamide.
| Compound Name | 7,14-dioxo-5,12-dihydroquinolino[2,3-b]acridine-1-carboxamide |
|---|---|
| PubChem CID | 139905975 |
| Molecular Formula | C21H13N3O3 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 7,14-dioxo-5,12-dihydroquinolino[2,3-b]acridine-1-carboxamide |
| SMILES | NC(=O)c1cccc2[nH]c3cc4c(=O)c5ccccc5[nH]c4cc3c(=O)c12 |
| InChI | InChI=1S/C21H13N3O3/c22-21(27)11-5-3-7-15-18(11)20(26)13-9-16-12(8-17(13)24-15)19(25)10-4-1-2-6-14(10)23-16/h1-9H,(H2,22,27)(H,23,25)(H,24,26) |
| InChIKey | OXLPJCMIBNMVOV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|