C23H19N3O2 — CID 140517849
3-(aminomethyl)-1,2-dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (PubChem CID 140517849) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-(aminomethyl)-1,2-dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 3-(aminomethyl)-1,2-dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 140517849 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-(aminomethyl)-1,2-dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
| SMILES | Cc1c(CN)cc2[nH]c3cc4c(=O)c5ccccc5[nH]c4cc3c(=O)c2c1C |
| InChI | InChI=1S/C23H19N3O2/c1-11-12(2)21-20(7-13(11)10-24)26-19-8-15-18(9-16(19)23(21)28)25-17-6-4-3-5-14(17)22(15)27/h3-9H,10,24H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | CZDJRLSARKZQTF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|