About 1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen
1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen (PubChem CID 144839444) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen.
Analyze 1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen?
The IUPAC name of 1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen (CID 144839444) is 1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen.
What is the SMILES notation for 1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen?
The canonical SMILES for 1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen is O=c1[nH]c2ccncc2[nH]1.[H][H].[H][H].
What is the InChIKey of 1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen?
The InChIKey is YIHZCVDVSUWUMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O.2H2/c10-6-8-4-1-2-7-3-5(4)9-6;;/h1-3H,(H2,8,9,10);2*1H.
What are the key properties of 1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen?
1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen has a molecular weight of 139.16 g/mol, XLogP of 0.74, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroimidazo[4,5-c]pyridin-2-one;molecular hydrogen is sourced from PubChem (CID 144839444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).