C7H5N3O — CID 28812113
4H-pyrido[3,4-b]pyrazin-3-one (PubChem CID 28812113) has the molecular formula C7H5N3O and a molecular weight of 147.14 g/mol. Its IUPAC name is 4H-pyrido[3,4-b]pyrazin-3-one.
| Compound Name | 4H-pyrido[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 28812113 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 4H-pyrido[3,4-b]pyrazin-3-one |
| SMILES | O=c1cnc2ccncc2[nH]1 |
| InChI | InChI=1S/C7H5N3O/c11-7-4-9-5-1-2-8-3-6(5)10-7/h1-4H,(H,10,11) |
| InChIKey | DPUUMESTNLIFDE-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |