About 6-oxo-5H-1,5-naphthyridine-3-carbonitrile
6-oxo-5H-1,5-naphthyridine-3-carbonitrile (PubChem CID 68864381) has the molecular formula C9H5N3O
and a molecular weight of 171.16 g/mol. Its IUPAC name is 6-oxo-5H-1,5-naphthyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-oxo-5H-1,5-naphthyridine-3-carbonitrile |
| PubChem CID | 68864381 |
| Molecular Formula | C9H5N3O |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | 6-oxo-5H-1,5-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1cnc2ccc(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H5N3O/c10-4-6-3-8-7(11-5-6)1-2-9(13)12-8/h1-3,5H,(H,12,13) |
| InChIKey | YDBVAJFYANTZEG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-oxo-5H-1,5-naphthyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-5H-1,5-naphthyridine-3-carbonitrile?
The IUPAC name of 6-oxo-5H-1,5-naphthyridine-3-carbonitrile (CID 68864381) is 6-oxo-5H-1,5-naphthyridine-3-carbonitrile.
What is the SMILES notation for 6-oxo-5H-1,5-naphthyridine-3-carbonitrile?
The canonical SMILES for 6-oxo-5H-1,5-naphthyridine-3-carbonitrile is N#Cc1cnc2ccc(=O)[nH]c2c1.
What is the InChIKey of 6-oxo-5H-1,5-naphthyridine-3-carbonitrile?
The InChIKey is YDBVAJFYANTZEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3O/c10-4-6-3-8-7(11-5-6)1-2-9(13)12-8/h1-3,5H,(H,12,13).
What are the key properties of 6-oxo-5H-1,5-naphthyridine-3-carbonitrile?
6-oxo-5H-1,5-naphthyridine-3-carbonitrile has a molecular weight of 171.16 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-5H-1,5-naphthyridine-3-carbonitrile is sourced from PubChem (CID 68864381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).