C10H10N2O — CID 13232050
5-ethyl-1H-1,6-naphthyridin-2-one (PubChem CID 13232050) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-ethyl-1H-1,6-naphthyridin-2-one.
| Compound Name | 5-ethyl-1H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 13232050 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 5-ethyl-1H-1,6-naphthyridin-2-one |
| SMILES | CCc1nccc2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C10H10N2O/c1-2-8-7-3-4-10(13)12-9(7)5-6-11-8/h3-6H,2H2,1H3,(H,12,13) |
| InChIKey | IFXSSJQOSYDWES-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |