C8H5N2OY- — CID 58916328
1,7-dihydroquinoxalin-7-id-2-one;yttrium (PubChem CID 58916328) has the molecular formula C8H5N2OY- and a molecular weight of 234.05 g/mol. Its IUPAC name is 1,7-dihydroquinoxalin-7-id-2-one;yttrium.
| Compound Name | 1,7-dihydroquinoxalin-7-id-2-one;yttrium |
|---|---|
| PubChem CID | 58916328 |
| Molecular Formula | C8H5N2OY- |
| Molecular Weight | 234.05 g/mol |
| Exact Mass | 233.95 |
| IUPAC Name | 1,7-dihydroquinoxalin-7-id-2-one;yttrium |
| SMILES | O=c1cnc2cc[c-]cc2[nH]1.[Y] |
| InChI | InChI=1S/C8H5N2O.Y/c11-8-5-9-6-3-1-2-4-7(6)10-8;/h1,3-5H,(H,10,11);/q-1; |
| InChIKey | SOZUHZVCVIEQGZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.05 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|