C14H7ClF2N2O — CID 175937083
7-chloro-6-(2,4-difluorophenyl)-1H-quinoxalin-2-one (PubChem CID 175937083) has the molecular formula C14H7ClF2N2O and a molecular weight of 292.67 g/mol. Its IUPAC name is 7-chloro-6-(2,4-difluorophenyl)-1H-quinoxalin-2-one.
| Compound Name | 7-chloro-6-(2,4-difluorophenyl)-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 175937083 |
| Molecular Formula | C14H7ClF2N2O |
| Molecular Weight | 292.67 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 7-chloro-6-(2,4-difluorophenyl)-1H-quinoxalin-2-one |
| SMILES | O=c1cnc2cc(-c3ccc(F)cc3F)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C14H7ClF2N2O/c15-10-5-13-12(18-6-14(20)19-13)4-9(10)8-2-1-7(16)3-11(8)17/h1-6H,(H,19,20) |
| InChIKey | NGIOCXLKADDDBA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |