C20H10Cl2F2N2O — CID 67270546
8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one (PubChem CID 67270546) has the molecular formula C20H10Cl2F2N2O and a molecular weight of 403.22 g/mol. Its IUPAC name is 8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one.
| Compound Name | 8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one |
|---|---|
| PubChem CID | 67270546 |
| Molecular Formula | C20H10Cl2F2N2O |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one |
| SMILES | O=c1cc(-c2ccc(F)cc2F)c2ccnc(-c3c(Cl)cccc3Cl)c2[nH]1 |
| InChI | InChI=1S/C20H10Cl2F2N2O/c21-14-2-1-3-15(22)18(14)20-19-12(6-7-25-20)13(9-17(27)26-19)11-5-4-10(23)8-16(11)24/h1-9H,(H,26,27) |
| InChIKey | LIFCIOYQHUIHQF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |