C20H11ClF2N2O2 — CID 67270821
8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-1H-1,7-naphthyridin-7-ium-2-one (PubChem CID 67270821) has the molecular formula C20H11ClF2N2O2 and a molecular weight of 384.77 g/mol. Its IUPAC name is 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-1H-1,7-naphthyridin-7-ium-2-one.
| Compound Name | 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-1H-1,7-naphthyridin-7-ium-2-one |
|---|---|
| PubChem CID | 67270821 |
| Molecular Formula | C20H11ClF2N2O2 |
| Molecular Weight | 384.77 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-1H-1,7-naphthyridin-7-ium-2-one |
| SMILES | O=c1cc(-c2ccc(F)cc2F)c2cc[n+]([O-])c(-c3ccccc3Cl)c2[nH]1 |
| InChI | InChI=1S/C20H11ClF2N2O2/c21-16-4-2-1-3-14(16)20-19-13(7-8-25(20)27)15(10-18(26)24-19)12-6-5-11(22)9-17(12)23/h1-10H,(H,24,26) |
| InChIKey | NDGMAGAPJFKSEZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.77 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|