C25H19F4N3O — CID 24899986
4-(2,4-difluorophenyl)-8-(2,6-difluorophenyl)-7-oxido-2-piperidin-4-yl-1,7-naphthyridin-7-ium (PubChem CID 24899986) has the molecular formula C25H19F4N3O and a molecular weight of 453.44 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-8-(2,6-difluorophenyl)-7-oxido-2-piperidin-4-yl-1,7-naphthyridin-7-ium.
| Compound Name | 4-(2,4-difluorophenyl)-8-(2,6-difluorophenyl)-7-oxido-2-piperidin-4-yl-1,7-naphthyridin-7-ium |
|---|---|
| PubChem CID | 24899986 |
| Molecular Formula | C25H19F4N3O |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 4-(2,4-difluorophenyl)-8-(2,6-difluorophenyl)-7-oxido-2-piperidin-4-yl-1,7-naphthyridin-7-ium |
| SMILES | [O-][n+]1ccc2c(-c3ccc(F)cc3F)cc(C3CCNCC3)nc2c1-c1c(F)cccc1F |
| InChI | InChI=1S/C25H19F4N3O/c26-15-4-5-16(21(29)12-15)18-13-22(14-6-9-30-10-7-14)31-24-17(18)8-11-32(33)25(24)23-19(27)2-1-3-20(23)28/h1-5,8,11-14,30H,6-7,9-10H2 |
| InChIKey | RPUXEEGYMIWYIF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|