C40H22ClF5N4O2 — CID 87616358
8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium;4-(2,4-difluorophenyl)-8-(2-fluorophenyl)-7-oxido-1,7-naphthyridin-7-ium (PubChem CID 87616358) has the molecular formula C40H22ClF5N4O2 and a molecular weight of 721.09 g/mol. Its IUPAC name is 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium;4-(2,4-difluorophenyl)-8-(2-fluorophenyl)-7-oxido-1,7-naphthyridin-7-ium.
| Compound Name | 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium;4-(2,4-difluorophenyl)-8-(2-fluorophenyl)-7-oxido-1,7-naphthyridin-7-ium |
|---|---|
| PubChem CID | 87616358 |
| Molecular Formula | C40H22ClF5N4O2 |
| Molecular Weight | 721.09 g/mol |
| Exact Mass | 720.14 |
| IUPAC Name | 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium;4-(2,4-difluorophenyl)-8-(2-fluorophenyl)-7-oxido-1,7-naphthyridin-7-ium |
| SMILES | [O-][n+]1ccc2c(-c3ccc(F)cc3F)ccnc2c1-c1ccccc1Cl.[O-][n+]1ccc2c(-c3ccc(F)cc3F)ccnc2c1-c1ccccc1F |
| InChI | InChI=1S/C20H11ClF2N2O.C20H11F3N2O/c21-17-4-2-1-3-16(17)20-19-15(8-10-25(20)26)13(7-9-24-19)14-6-5-12(22)11-18(14)23;21-12-5-6-14(18(23)11-12)13-7-9-24-19-15(13)8-10-25(26)20(19)16-3-1-2-4-17(16)22/h2*1-11H |
| InChIKey | VNVNVSKZEOSBFN-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 79.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.09 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|