C24H18Cl2F2N4O — CID 24898752
8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-2-piperazin-1-yl-1,7-naphthyridin-7-ium (PubChem CID 24898752) has the molecular formula C24H18Cl2F2N4O and a molecular weight of 487.34 g/mol. Its IUPAC name is 8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-2-piperazin-1-yl-1,7-naphthyridin-7-ium.
| Compound Name | 8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-2-piperazin-1-yl-1,7-naphthyridin-7-ium |
|---|---|
| PubChem CID | 24898752 |
| Molecular Formula | C24H18Cl2F2N4O |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | 8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-7-oxido-2-piperazin-1-yl-1,7-naphthyridin-7-ium |
| SMILES | [O-][n+]1ccc2c(-c3ccc(F)cc3F)cc(N3CCNCC3)nc2c1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H18Cl2F2N4O/c25-18-2-1-3-19(26)22(18)24-23-16(6-9-32(24)33)17(15-5-4-14(27)12-20(15)28)13-21(30-23)31-10-7-29-8-11-31/h1-6,9,12-13,29H,7-8,10-11H2 |
| InChIKey | JRSJXTUTYZIQIF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|