C21H12F2N2O3 — CID 24899479
8-(1,3-benzodioxol-4-yl)-4-(2,4-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium (PubChem CID 24899479) has the molecular formula C21H12F2N2O3 and a molecular weight of 378.33 g/mol. Its IUPAC name is 8-(1,3-benzodioxol-4-yl)-4-(2,4-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium.
| Compound Name | 8-(1,3-benzodioxol-4-yl)-4-(2,4-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium |
|---|---|
| PubChem CID | 24899479 |
| Molecular Formula | C21H12F2N2O3 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 8-(1,3-benzodioxol-4-yl)-4-(2,4-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium |
| SMILES | [O-][n+]1ccc2c(-c3ccc(F)cc3F)ccnc2c1-c1cccc2c1OCO2 |
| InChI | InChI=1S/C21H12F2N2O3/c22-12-4-5-14(17(23)10-12)13-6-8-24-19-15(13)7-9-25(26)20(19)16-2-1-3-18-21(16)28-11-27-18/h1-10H,11H2 |
| InChIKey | YKQSYGYOGXKYNK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|