C13H11FN2O2 — CID 106194181
N-(1,3-benzodioxol-4-ylmethyl)-2-fluoropyridin-4-amine (PubChem CID 106194181) has the molecular formula C13H11FN2O2 and a molecular weight of 246.24 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-2-fluoropyridin-4-amine.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-2-fluoropyridin-4-amine |
|---|---|
| PubChem CID | 106194181 |
| Molecular Formula | C13H11FN2O2 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-2-fluoropyridin-4-amine |
| SMILES | Fc1cc(NCc2cccc3c2OCO3)ccn1 |
| InChI | InChI=1S/C13H11FN2O2/c14-12-6-10(4-5-15-12)16-7-9-2-1-3-11-13(9)18-8-17-11/h1-6H,7-8H2,(H,15,16) |
| InChIKey | PGDBRVXTUKMWPR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|