C11H11N3O2 — CID 43583965
N-(1,3-benzodioxol-4-ylmethyl)-1H-pyrazol-4-amine (PubChem CID 43583965) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-1H-pyrazol-4-amine.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 43583965 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-1H-pyrazol-4-amine |
| SMILES | c1cc(CNc2cn[nH]c2)c2c(c1)OCO2 |
| InChI | InChI=1S/C11H11N3O2/c1-2-8(4-12-9-5-13-14-6-9)11-10(3-1)15-7-16-11/h1-3,5-6,12H,4,7H2,(H,13,14) |
| InChIKey | BXPYISPOPYUHHF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |