C18H15NO2 — CID 43680230
N-(1,3-benzodioxol-4-ylmethyl)naphthalen-2-amine (PubChem CID 43680230) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)naphthalen-2-amine.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 43680230 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)naphthalen-2-amine |
| SMILES | c1cc(CNc2ccc3ccccc3c2)c2c(c1)OCO2 |
| InChI | InChI=1S/C18H15NO2/c1-2-5-14-10-16(9-8-13(14)4-1)19-11-15-6-3-7-17-18(15)21-12-20-17/h1-10,19H,11-12H2 |
| InChIKey | LANLNEMOVMAULV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |