C15H13NO5 — CID 127031137
5-(1,3-benzodioxol-4-ylmethylamino)-2-hydroxybenzoic acid (PubChem CID 127031137) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-4-ylmethylamino)-2-hydroxybenzoic acid.
| Compound Name | 5-(1,3-benzodioxol-4-ylmethylamino)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 127031137 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 5-(1,3-benzodioxol-4-ylmethylamino)-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(NCc2cccc3c2OCO3)ccc1O |
| InChI | InChI=1S/C15H13NO5/c17-12-5-4-10(6-11(12)15(18)19)16-7-9-2-1-3-13-14(9)21-8-20-13/h1-6,16-17H,7-8H2,(H,18,19) |
| InChIKey | WNVGHUTXAIKUJK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|