C10H9N3O2S — CID 107234328
N-(1,3-benzodioxol-4-ylmethyl)thiadiazol-5-amine (PubChem CID 107234328) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)thiadiazol-5-amine.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)thiadiazol-5-amine |
|---|---|
| PubChem CID | 107234328 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)thiadiazol-5-amine |
| SMILES | c1cc(CNc2cnns2)c2c(c1)OCO2 |
| InChI | InChI=1S/C10H9N3O2S/c1-2-7(4-11-9-5-12-13-16-9)10-8(3-1)14-6-15-10/h1-3,5,11H,4,6H2 |
| InChIKey | YPVGNZHYFSSVEP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |