C19H16N2O2 — CID 112844052
N-(1,3-benzodioxol-4-ylmethyl)-5-phenylpyridin-2-amine (PubChem CID 112844052) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-5-phenylpyridin-2-amine.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-5-phenylpyridin-2-amine |
|---|---|
| PubChem CID | 112844052 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-5-phenylpyridin-2-amine |
| SMILES | c1ccc(-c2ccc(NCc3cccc4c3OCO4)nc2)cc1 |
| InChI | InChI=1S/C19H16N2O2/c1-2-5-14(6-3-1)15-9-10-18(20-11-15)21-12-16-7-4-8-17-19(16)23-13-22-17/h1-11H,12-13H2,(H,20,21) |
| InChIKey | RAOXJPGICSRUIF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |