C14H11FN2O3 — CID 61293674
N-(1,3-benzodioxol-4-ylmethyl)-2-fluoropyridine-4-carboxamide (PubChem CID 61293674) has the molecular formula C14H11FN2O3 and a molecular weight of 274.25 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-2-fluoropyridine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 61293674 |
| Molecular Formula | C14H11FN2O3 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-2-fluoropyridine-4-carboxamide |
| SMILES | O=C(NCc1cccc2c1OCO2)c1ccnc(F)c1 |
| InChI | InChI=1S/C14H11FN2O3/c15-12-6-9(4-5-16-12)14(18)17-7-10-2-1-3-11-13(10)20-8-19-11/h1-6H,7-8H2,(H,17,18) |
| InChIKey | ZHPXXRHADMIUBB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|