C15H13FN2O3 — CID 107794291
4-amino-N-(1,3-benzodioxol-4-ylmethyl)-2-fluorobenzamide (PubChem CID 107794291) has the molecular formula C15H13FN2O3 and a molecular weight of 288.28 g/mol. Its IUPAC name is 4-amino-N-(1,3-benzodioxol-4-ylmethyl)-2-fluorobenzamide.
| Compound Name | 4-amino-N-(1,3-benzodioxol-4-ylmethyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 107794291 |
| Molecular Formula | C15H13FN2O3 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-amino-N-(1,3-benzodioxol-4-ylmethyl)-2-fluorobenzamide |
| SMILES | Nc1ccc(C(=O)NCc2cccc3c2OCO3)c(F)c1 |
| InChI | InChI=1S/C15H13FN2O3/c16-12-6-10(17)4-5-11(12)15(19)18-7-9-2-1-3-13-14(9)21-8-20-13/h1-6H,7-8,17H2,(H,18,19) |
| InChIKey | KLBSHUWKTKOXNW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|