C15H11BrFNO3 — CID 55899212
N-[(2-bromo-5-fluorophenyl)methyl]-1,3-benzodioxole-4-carboxamide (PubChem CID 55899212) has the molecular formula C15H11BrFNO3 and a molecular weight of 352.16 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-1,3-benzodioxole-4-carboxamide.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-1,3-benzodioxole-4-carboxamide |
|---|---|
| PubChem CID | 55899212 |
| Molecular Formula | C15H11BrFNO3 |
| Molecular Weight | 352.16 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-1,3-benzodioxole-4-carboxamide |
| SMILES | O=C(NCc1cc(F)ccc1Br)c1cccc2c1OCO2 |
| InChI | InChI=1S/C15H11BrFNO3/c16-12-5-4-10(17)6-9(12)7-18-15(19)11-2-1-3-13-14(11)21-8-20-13/h1-6H,7-8H2,(H,18,19) |
| InChIKey | WCZKNHVELZTEDR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.16 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |