About 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane
1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane (PubChem CID 156797432) has the molecular formula C15H15ClF2
and a molecular weight of 268.73 g/mol. Its IUPAC name is 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane.
Molecular Properties
| Compound Name | 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane |
| PubChem CID | 156797432 |
| Molecular Formula | C15H15ClF2 |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane |
| SMILES | CC.Cc1cccc(Cl)c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C13H9ClF2.C2H6/c1-8-3-2-4-11(14)13(8)10-6-5-9(15)7-12(10)16;1-2/h2-7H,1H3;1-2H3 |
| InChIKey | LIOBUTDWOFMUHS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane?
The IUPAC name of 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane (CID 156797432) is 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane.
What is the SMILES notation for 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane?
The canonical SMILES for 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane is CC.Cc1cccc(Cl)c1-c1ccc(F)cc1F.
What is the InChIKey of 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane?
The InChIKey is LIOBUTDWOFMUHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClF2.C2H6/c1-8-3-2-4-11(14)13(8)10-6-5-9(15)7-12(10)16;1-2/h2-7H,1H3;1-2H3.
What are the key properties of 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane?
1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane has a molecular weight of 268.73 g/mol, XLogP of 5.62, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane is sourced from PubChem (CID 156797432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).