C15H15ClF2 — CID 156797432
1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane (PubChem CID 156797432) has the molecular formula C15H15ClF2 and a molecular weight of 268.73 g/mol. Its IUPAC name is 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane.
| Compound Name | 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane |
|---|---|
| PubChem CID | 156797432 |
| Molecular Formula | C15H15ClF2 |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-chloro-2-(2,4-difluorophenyl)-3-methylbenzene;ethane |
| SMILES | CC.Cc1cccc(Cl)c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C13H9ClF2.C2H6/c1-8-3-2-4-11(14)13(8)10-6-5-9(15)7-12(10)16;1-2/h2-7H,1H3;1-2H3 |
| InChIKey | LIOBUTDWOFMUHS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |