C12H5Cl2F3 — CID 119023512
1-(2,6-dichlorophenyl)-2,3,5-trifluorobenzene (PubChem CID 119023512) has the molecular formula C12H5Cl2F3 and a molecular weight of 277.07 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-2,3,5-trifluorobenzene.
| Compound Name | 1-(2,6-dichlorophenyl)-2,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 119023512 |
| Molecular Formula | C12H5Cl2F3 |
| Molecular Weight | 277.07 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-2,3,5-trifluorobenzene |
| SMILES | Fc1cc(F)c(F)c(-c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C12H5Cl2F3/c13-8-2-1-3-9(14)11(8)7-4-6(15)5-10(16)12(7)17/h1-5H |
| InChIKey | DCRNVHKDQPXGSL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.07 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|