C12H6Cl2F2O — CID 119020027
2-(2,6-dichlorophenyl)-4,5-difluorophenol (PubChem CID 119020027) has the molecular formula C12H6Cl2F2O and a molecular weight of 275.08 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-4,5-difluorophenol.
| Compound Name | 2-(2,6-dichlorophenyl)-4,5-difluorophenol |
|---|---|
| PubChem CID | 119020027 |
| Molecular Formula | C12H6Cl2F2O |
| Molecular Weight | 275.08 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-4,5-difluorophenol |
| SMILES | Oc1cc(F)c(F)cc1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H6Cl2F2O/c13-7-2-1-3-8(14)12(7)6-4-9(15)10(16)5-11(6)17/h1-5,17H |
| InChIKey | UFJIMFSVGNNECH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.08 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |