C12H8Cl2INaO — CID 173433912
sodium;3-(2,6-dichlorophenyl)-2-iodophenol;hydride (PubChem CID 173433912) has the molecular formula C12H8Cl2INaO and a molecular weight of 389.00 g/mol. Its IUPAC name is sodium;3-(2,6-dichlorophenyl)-2-iodophenol;hydride.
| Compound Name | sodium;3-(2,6-dichlorophenyl)-2-iodophenol;hydride |
|---|---|
| PubChem CID | 173433912 |
| Molecular Formula | C12H8Cl2INaO |
| Molecular Weight | 389.00 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | sodium;3-(2,6-dichlorophenyl)-2-iodophenol;hydride |
| SMILES | Oc1cccc(-c2c(Cl)cccc2Cl)c1I.[H-].[Na+] |
| InChI | InChI=1S/C12H7Cl2IO.Na.H/c13-8-4-2-5-9(14)11(8)7-3-1-6-10(16)12(7)15;;/h1-6,16H;;/q;+1;-1 |
| InChIKey | ZKGYIVTWBDKZIP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.00 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|