C12H9ClO2 — CID 163363337
2-(2-chlorophenyl)benzene-1,3-diol (PubChem CID 163363337) has the molecular formula C12H9ClO2 and a molecular weight of 220.66 g/mol. Its IUPAC name is 2-(2-chlorophenyl)benzene-1,3-diol.
| Compound Name | 2-(2-chlorophenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 163363337 |
| Molecular Formula | C12H9ClO2 |
| Molecular Weight | 220.66 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 2-(2-chlorophenyl)benzene-1,3-diol |
| SMILES | Oc1cccc(O)c1-c1ccccc1Cl |
| InChI | InChI=1S/C12H9ClO2/c13-9-5-2-1-4-8(9)12-10(14)6-3-7-11(12)15/h1-7,14-15H |
| InChIKey | BKNURZDJKNQZOK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.66 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |