About CID 173103986
CID 173103986 (PubChem CID 173103986) has the molecular formula C18H11Cl2Se
and a molecular weight of 377.15 g/mol.
Molecular Properties
| Compound Name | CID 173103986 |
| PubChem CID | 173103986 |
| Molecular Formula | C18H11Cl2Se |
| Molecular Weight | 377.15 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | — |
| SMILES | Clc1ccccc1-c1cccc([Se])c1-c1ccccc1Cl |
| InChI | InChI=1S/C18H11Cl2Se/c19-15-9-3-1-6-12(15)13-8-5-11-17(21)18(13)14-7-2-4-10-16(14)20/h1-11H |
| InChIKey | FURXGPKDUXTLFR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.15 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173103986 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173103986?
The IUPAC name of CID 173103986 (CID 173103986) is not available.
What is the SMILES notation for CID 173103986?
The canonical SMILES for CID 173103986 is Clc1ccccc1-c1cccc([Se])c1-c1ccccc1Cl.
What is the InChIKey of CID 173103986?
The InChIKey is FURXGPKDUXTLFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Cl2Se/c19-15-9-3-1-6-12(15)13-8-5-11-17(21)18(13)14-7-2-4-10-16(14)20/h1-11H.
What are the key properties of CID 173103986?
CID 173103986 has a molecular weight of 377.15 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173103986 is sourced from PubChem (CID 173103986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).