C12H10ClNO2 — CID 54719903
3-(2-chlorophenyl)-4-hydroxy-6-methyl-1H-pyridin-2-one (PubChem CID 54719903) has the molecular formula C12H10ClNO2 and a molecular weight of 235.67 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-4-hydroxy-6-methyl-1H-pyridin-2-one.
| Compound Name | 3-(2-chlorophenyl)-4-hydroxy-6-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 54719903 |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 3-(2-chlorophenyl)-4-hydroxy-6-methyl-1H-pyridin-2-one |
| SMILES | Cc1cc(O)c(-c2ccccc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C12H10ClNO2/c1-7-6-10(15)11(12(16)14-7)8-4-2-3-5-9(8)13/h2-6H,1H3,(H2,14,15,16) |
| InChIKey | ZNTKEGIGJYESED-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |