About sodium;2,6-dichlorophenolate;2-iodophenol
sodium;2,6-dichlorophenolate;2-iodophenol (PubChem CID 175356810) has the molecular formula C12H8Cl2INaO2
and a molecular weight of 404.99 g/mol. Its IUPAC name is sodium;2,6-dichlorophenolate;2-iodophenol.
Molecular Properties
| Compound Name | sodium;2,6-dichlorophenolate;2-iodophenol |
| PubChem CID | 175356810 |
| Molecular Formula | C12H8Cl2INaO2 |
| Molecular Weight | 404.99 g/mol |
| Exact Mass | 403.88 |
| IUPAC Name | sodium;2,6-dichlorophenolate;2-iodophenol |
| SMILES | Oc1ccccc1I.[Na+].[O-]c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C6H4Cl2O.C6H5IO.Na/c7-4-2-1-3-5(8)6(4)9;7-5-3-1-2-4-6(5)8;/h1-3,9H;1-4,8H;/q;;+1/p-1 |
| InChIKey | MCYRZGLWZGBWHY-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.99 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium;2,6-dichlorophenolate;2-iodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2,6-dichlorophenolate;2-iodophenol?
The IUPAC name of sodium;2,6-dichlorophenolate;2-iodophenol (CID 175356810) is sodium;2,6-dichlorophenolate;2-iodophenol.
What is the SMILES notation for sodium;2,6-dichlorophenolate;2-iodophenol?
The canonical SMILES for sodium;2,6-dichlorophenolate;2-iodophenol is Oc1ccccc1I.[Na+].[O-]c1c(Cl)cccc1Cl.
What is the InChIKey of sodium;2,6-dichlorophenolate;2-iodophenol?
The InChIKey is MCYRZGLWZGBWHY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H4Cl2O.C6H5IO.Na/c7-4-2-1-3-5(8)6(4)9;7-5-3-1-2-4-6(5)8;/h1-3,9H;1-4,8H;/q;;+1/p-1.
What are the key properties of sodium;2,6-dichlorophenolate;2-iodophenol?
sodium;2,6-dichlorophenolate;2-iodophenol has a molecular weight of 404.99 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2,6-dichlorophenolate;2-iodophenol is sourced from PubChem (CID 175356810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).