C12H8Cl3IO2 — CID 154941480
2-iodophenol;3,4,5-trichlorophenol (PubChem CID 154941480) has the molecular formula C12H8Cl3IO2 and a molecular weight of 417.46 g/mol. Its IUPAC name is 2-iodophenol;3,4,5-trichlorophenol.
| Compound Name | 2-iodophenol;3,4,5-trichlorophenol |
|---|---|
| PubChem CID | 154941480 |
| Molecular Formula | C12H8Cl3IO2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 415.86 |
| IUPAC Name | 2-iodophenol;3,4,5-trichlorophenol |
| SMILES | Oc1cc(Cl)c(Cl)c(Cl)c1.Oc1ccccc1I |
| InChI | InChI=1S/C6H3Cl3O.C6H5IO/c7-4-1-3(10)2-5(8)6(4)9;7-5-3-1-2-4-6(5)8/h1-2,10H;1-4,8H |
| InChIKey | AAOZTRLYEZVTPR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|