About 2-iodophenol;4-iodophenol
2-iodophenol;4-iodophenol (PubChem CID 67440889) has the molecular formula C12H10I2O2
and a molecular weight of 440.02 g/mol. Its IUPAC name is 2-iodophenol;4-iodophenol.
Molecular Properties
| Compound Name | 2-iodophenol;4-iodophenol |
| PubChem CID | 67440889 |
| Molecular Formula | C12H10I2O2 |
| Molecular Weight | 440.02 g/mol |
| Exact Mass | 439.88 |
| IUPAC Name | 2-iodophenol;4-iodophenol |
| SMILES | Oc1ccc(I)cc1.Oc1ccccc1I |
| InChI | InChI=1S/2C6H5IO/c7-5-1-3-6(8)4-2-5;7-5-3-1-2-4-6(5)8/h2*1-4,8H |
| InChIKey | YSOMFPVQLWHJHI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.02 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodophenol;4-iodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodophenol;4-iodophenol?
The IUPAC name of 2-iodophenol;4-iodophenol (CID 67440889) is 2-iodophenol;4-iodophenol.
What is the SMILES notation for 2-iodophenol;4-iodophenol?
The canonical SMILES for 2-iodophenol;4-iodophenol is Oc1ccc(I)cc1.Oc1ccccc1I.
What is the InChIKey of 2-iodophenol;4-iodophenol?
The InChIKey is YSOMFPVQLWHJHI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5IO/c7-5-1-3-6(8)4-2-5;7-5-3-1-2-4-6(5)8/h2*1-4,8H.
What are the key properties of 2-iodophenol;4-iodophenol?
2-iodophenol;4-iodophenol has a molecular weight of 440.02 g/mol, XLogP of 3.99, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodophenol;4-iodophenol is sourced from PubChem (CID 67440889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).