About actinium;2,5-diiodophenol
actinium;2,5-diiodophenol (PubChem CID 59887168) has the molecular formula C6H4AcI2O
and a molecular weight of 572.90 g/mol. Its IUPAC name is actinium;2,5-diiodophenol.
Molecular Properties
| Compound Name | actinium;2,5-diiodophenol |
| PubChem CID | 59887168 |
| Molecular Formula | C6H4AcI2O |
| Molecular Weight | 572.90 g/mol |
| Exact Mass | 572.86 |
| IUPAC Name | actinium;2,5-diiodophenol |
| SMILES | Oc1cc(I)ccc1I.[Ac] |
| InChI | InChI=1S/C6H4I2O.Ac/c7-4-1-2-5(8)6(9)3-4;/h1-3,9H; |
| InChIKey | ZOQOXULHWSRAST-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 572.90 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze actinium;2,5-diiodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;2,5-diiodophenol?
The IUPAC name of actinium;2,5-diiodophenol (CID 59887168) is actinium;2,5-diiodophenol.
What is the SMILES notation for actinium;2,5-diiodophenol?
The canonical SMILES for actinium;2,5-diiodophenol is Oc1cc(I)ccc1I.[Ac].
What is the InChIKey of actinium;2,5-diiodophenol?
The InChIKey is ZOQOXULHWSRAST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4I2O.Ac/c7-4-1-2-5(8)6(9)3-4;/h1-3,9H;.
What are the key properties of actinium;2,5-diiodophenol?
actinium;2,5-diiodophenol has a molecular weight of 572.90 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;2,5-diiodophenol is sourced from PubChem (CID 59887168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).