About 7-iodoisoquinolin-4-ol
7-iodoisoquinolin-4-ol (PubChem CID 151672694) has the molecular formula C9H6INO
and a molecular weight of 271.06 g/mol. Its IUPAC name is 7-iodoisoquinolin-4-ol.
Molecular Properties
| Compound Name | 7-iodoisoquinolin-4-ol |
| PubChem CID | 151672694 |
| Molecular Formula | C9H6INO |
| Molecular Weight | 271.06 g/mol |
| Exact Mass | 270.95 |
| IUPAC Name | 7-iodoisoquinolin-4-ol |
| SMILES | Oc1cncc2cc(I)ccc12 |
| InChI | InChI=1S/C9H6INO/c10-7-1-2-8-6(3-7)4-11-5-9(8)12/h1-5,12H |
| InChIKey | QYWSWFIXVILIJV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.06 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodoisoquinolin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodoisoquinolin-4-ol?
The IUPAC name of 7-iodoisoquinolin-4-ol (CID 151672694) is 7-iodoisoquinolin-4-ol.
What is the SMILES notation for 7-iodoisoquinolin-4-ol?
The canonical SMILES for 7-iodoisoquinolin-4-ol is Oc1cncc2cc(I)ccc12.
What is the InChIKey of 7-iodoisoquinolin-4-ol?
The InChIKey is QYWSWFIXVILIJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6INO/c10-7-1-2-8-6(3-7)4-11-5-9(8)12/h1-5,12H.
What are the key properties of 7-iodoisoquinolin-4-ol?
7-iodoisoquinolin-4-ol has a molecular weight of 271.06 g/mol, XLogP of 2.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodoisoquinolin-4-ol is sourced from PubChem (CID 151672694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).