About 7-iodonaphthalene-1,3-diol
7-iodonaphthalene-1,3-diol (PubChem CID 176890151) has the molecular formula C10H7IO2
and a molecular weight of 286.07 g/mol. Its IUPAC name is 7-iodonaphthalene-1,3-diol.
Molecular Properties
| Compound Name | 7-iodonaphthalene-1,3-diol |
| PubChem CID | 176890151 |
| Molecular Formula | C10H7IO2 |
| Molecular Weight | 286.07 g/mol |
| Exact Mass | 285.95 |
| IUPAC Name | 7-iodonaphthalene-1,3-diol |
| SMILES | Oc1cc(O)c2cc(I)ccc2c1 |
| InChI | InChI=1S/C10H7IO2/c11-7-2-1-6-3-8(12)5-10(13)9(6)4-7/h1-5,12-13H |
| InChIKey | JMCSPXJKPILXCH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.07 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodonaphthalene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodonaphthalene-1,3-diol?
The IUPAC name of 7-iodonaphthalene-1,3-diol (CID 176890151) is 7-iodonaphthalene-1,3-diol.
What is the SMILES notation for 7-iodonaphthalene-1,3-diol?
The canonical SMILES for 7-iodonaphthalene-1,3-diol is Oc1cc(O)c2cc(I)ccc2c1.
What is the InChIKey of 7-iodonaphthalene-1,3-diol?
The InChIKey is JMCSPXJKPILXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7IO2/c11-7-2-1-6-3-8(12)5-10(13)9(6)4-7/h1-5,12-13H.
What are the key properties of 7-iodonaphthalene-1,3-diol?
7-iodonaphthalene-1,3-diol has a molecular weight of 286.07 g/mol, XLogP of 2.86, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodonaphthalene-1,3-diol is sourced from PubChem (CID 176890151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).