C10H9NO2 — CID 105435991
3-aminonaphthalene-1,7-diol (PubChem CID 105435991) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-aminonaphthalene-1,7-diol.
| Compound Name | 3-aminonaphthalene-1,7-diol |
|---|---|
| PubChem CID | 105435991 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 3-aminonaphthalene-1,7-diol |
| SMILES | Nc1cc(O)c2cc(O)ccc2c1 |
| InChI | InChI=1S/C10H9NO2/c11-7-3-6-1-2-8(12)5-9(6)10(13)4-7/h1-5,12-13H,11H2 |
| InChIKey | LFAOBFUETYNKQE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|