C11H10O3 — CID 159488157
2-methylnaphthalene-1,3,7-triol (PubChem CID 159488157) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-methylnaphthalene-1,3,7-triol.
| Compound Name | 2-methylnaphthalene-1,3,7-triol |
|---|---|
| PubChem CID | 159488157 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2-methylnaphthalene-1,3,7-triol |
| SMILES | Cc1c(O)cc2ccc(O)cc2c1O |
| InChI | InChI=1S/C11H10O3/c1-6-10(13)4-7-2-3-8(12)5-9(7)11(6)14/h2-5,12-14H,1H3 |
| InChIKey | QXDPPZHJCIBUCZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |