C11H11NO2 — CID 137277383
3,7-dimethylisoquinoline-6,8-diol (PubChem CID 137277383) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 3,7-dimethylisoquinoline-6,8-diol.
| Compound Name | 3,7-dimethylisoquinoline-6,8-diol |
|---|---|
| PubChem CID | 137277383 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 3,7-dimethylisoquinoline-6,8-diol |
| SMILES | Cc1cc2cc(O)c(C)c(O)c2cn1 |
| InChI | InChI=1S/C11H11NO2/c1-6-3-8-4-10(13)7(2)11(14)9(8)5-12-6/h3-5,13-14H,1-2H3 |
| InChIKey | BKLWFSIIGMVQHX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |