C22H18O2 — CID 153453254
6-(6-hydroxy-5-methylnaphthalen-2-yl)-1-methylnaphthalen-2-ol (PubChem CID 153453254) has the molecular formula C22H18O2 and a molecular weight of 314.38 g/mol. Its IUPAC name is 6-(6-hydroxy-5-methylnaphthalen-2-yl)-1-methylnaphthalen-2-ol.
| Compound Name | 6-(6-hydroxy-5-methylnaphthalen-2-yl)-1-methylnaphthalen-2-ol |
|---|---|
| PubChem CID | 153453254 |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 6-(6-hydroxy-5-methylnaphthalen-2-yl)-1-methylnaphthalen-2-ol |
| SMILES | Cc1c(O)ccc2cc(-c3ccc4c(C)c(O)ccc4c3)ccc12 |
| InChI | InChI=1S/C22H18O2/c1-13-19-7-3-15(11-17(19)5-9-21(13)23)16-4-8-20-14(2)22(24)10-6-18(20)12-16/h3-12,23-24H,1-2H3 |
| InChIKey | LZZTVWXLZVYGLY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |