C26H18O2 — CID 90294470
4-[7-(4-hydroxyphenyl)phenanthren-2-yl]phenol (PubChem CID 90294470) has the molecular formula C26H18O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-[7-(4-hydroxyphenyl)phenanthren-2-yl]phenol.
| Compound Name | 4-[7-(4-hydroxyphenyl)phenanthren-2-yl]phenol |
|---|---|
| PubChem CID | 90294470 |
| Molecular Formula | C26H18O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 4-[7-(4-hydroxyphenyl)phenanthren-2-yl]phenol |
| SMILES | Oc1ccc(-c2ccc3c(ccc4cc(-c5ccc(O)cc5)ccc43)c2)cc1 |
| InChI | InChI=1S/C26H18O2/c27-23-9-3-17(4-10-23)19-7-13-25-21(15-19)1-2-22-16-20(8-14-26(22)25)18-5-11-24(28)12-6-18/h1-16,27-28H |
| InChIKey | PCSVLCFTOAWKES-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|