C15H15NO7S — CID 20736900
2-[carboxymethyl-(6-hydroxy-5-methylnaphthalen-2-yl)sulfonylamino]acetic acid (PubChem CID 20736900) has the molecular formula C15H15NO7S and a molecular weight of 353.35 g/mol. Its IUPAC name is 2-[carboxymethyl-(6-hydroxy-5-methylnaphthalen-2-yl)sulfonylamino]acetic acid.
| Compound Name | 2-[carboxymethyl-(6-hydroxy-5-methylnaphthalen-2-yl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 20736900 |
| Molecular Formula | C15H15NO7S |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-[carboxymethyl-(6-hydroxy-5-methylnaphthalen-2-yl)sulfonylamino]acetic acid |
| SMILES | Cc1c(O)ccc2cc(S(=O)(=O)N(CC(=O)O)CC(=O)O)ccc12 |
| InChI | InChI=1S/C15H15NO7S/c1-9-12-4-3-11(6-10(12)2-5-13(9)17)24(22,23)16(7-14(18)19)8-15(20)21/h2-6,17H,7-8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | FULDPZQDPYLFCG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |