C12H13NO6S2 — CID 79272293
2-[(4-methylsulfonylphenyl)sulfonyl-prop-2-ynylamino]acetic acid (PubChem CID 79272293) has the molecular formula C12H13NO6S2 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[(4-methylsulfonylphenyl)sulfonyl-prop-2-ynylamino]acetic acid.
| Compound Name | 2-[(4-methylsulfonylphenyl)sulfonyl-prop-2-ynylamino]acetic acid |
|---|---|
| PubChem CID | 79272293 |
| Molecular Formula | C12H13NO6S2 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-[(4-methylsulfonylphenyl)sulfonyl-prop-2-ynylamino]acetic acid |
| SMILES | C#CCN(CC(=O)O)S(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H13NO6S2/c1-3-8-13(9-12(14)15)21(18,19)11-6-4-10(5-7-11)20(2,16)17/h1,4-7H,8-9H2,2H3,(H,14,15) |
| InChIKey | DLTBRRWZGYCOKJ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|