C13H15NO4S — CID 79274786
2-[(2,4-dimethylphenyl)sulfonyl-prop-2-ynylamino]acetic acid (PubChem CID 79274786) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenyl)sulfonyl-prop-2-ynylamino]acetic acid.
| Compound Name | 2-[(2,4-dimethylphenyl)sulfonyl-prop-2-ynylamino]acetic acid |
|---|---|
| PubChem CID | 79274786 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-[(2,4-dimethylphenyl)sulfonyl-prop-2-ynylamino]acetic acid |
| SMILES | C#CCN(CC(=O)O)S(=O)(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C13H15NO4S/c1-4-7-14(9-13(15)16)19(17,18)12-6-5-10(2)8-11(12)3/h1,5-6,8H,7,9H2,2-3H3,(H,15,16) |
| InChIKey | HSGFDFRNNVFVMR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|